CAS 2639638-66-5 appears in our catalog under these names: BAY-069/ 98.83% (existing batch purity), BAY–069, BAY-069, BAY-069, 99.54%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (CAS 2639638-66-5) is a chemical compound with the molecular formula C22H14ClF3N2O3 and a molecular weight of 446.8 g/mol. IUPAC name: 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione. InChIKey: UNSHMXUHOHBLIQ-UHFFFAOYSA-N.
| Molecular formula | C22H14ClF3N2O3 |
|---|---|
| Molecular weight | 446.8 g/mol |
| IUPAC name | 3-[4-chloro-3-(2-methylphenoxy)naphthalen-1-yl]-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | UNSHMXUHOHBLIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=C(C3=CC=CC=C3C(=C2)N4C(=O)C=C(NC4=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)