CAS 1891087-61-8 appears in our catalog under these names: BAY-1816032/ 98.02% (existing batch purity), BAY–1816032, BAY 1816032, BAY-1816032 99%, BAY-1816032, 99.32% ,, 99.32% ,. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
2-[3,5-difluoro-4-[[3-[5-methoxy-4-[(3-methoxy-4-pyridinyl)amino]pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]ethanol (CAS 1891087-61-8) is a chemical compound with the molecular formula C27H24F2N6O4 and a molecular weight of 534.5 g/mol. IUPAC name: 2-[3,5-difluoro-4-[[3-[5-methoxy-4-[(3-methoxy-4-pyridinyl)amino]pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]ethanol. InChIKey: QVOGVAVHOLLLAZ-UHFFFAOYSA-N.
| Molecular formula | C27H24F2N6O4 |
|---|---|
| Molecular weight | 534.5 g/mol |
| IUPAC name | 2-[3,5-difluoro-4-[[3-[5-methoxy-4-[(3-methoxy-4-pyridinyl)amino]pyrimidin-2-yl]indazol-1-yl]methyl]phenoxy]ethanol |
| InChIKey | QVOGVAVHOLLLAZ-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(N=C1NC2=C(C=NC=C2)OC)C3=NN(C4=CC=CC=C43)CC5=C(C=C(C=C5F)OCCO)F |
Computed by PubChem (NCBI)