Products 2080306-23-4
CAS 2080306-23-4 appears in our catalog under these names: BAY-299/ 97.5% (existing batch purity), BAY–299, BAY 299, BAY-299 99%, BAY 299, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 0,025g, 0,002g.
6-(3-hydroxypropyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione (CAS 2080306-23-4) is a chemical compound with the molecular formula C25H23N3O4 and a molecular weight of 429.5 g/mol. IUPAC name: 6-(3-hydroxypropyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione. InChIKey: OFWWWKWUCDUISA-UHFFFAOYSA-N.
| Molecular formula | C25H23N3O4 |
|---|---|
| Molecular weight | 429.5 g/mol |
| IUPAC name | 6-(3-hydroxypropyl)-2-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)benzo[de]isoquinoline-1,3-dione |
| InChIKey | OFWWWKWUCDUISA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N3C(=O)C4=C5C(=C(C=C4)CCCO)C=CC=C5C3=O)N(C(=O)N2C)C |
Computed by PubChem (NCBI)
Synonyms:
orb1308583