CAS 233255-39-5 appears in our catalog under these names: BAY-43-9695/ 99.31% (existing batch purity), BAY-43-9695. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
3-hydroxy-2,2-dimethyl-N-[4-[[5-(methylamino)naphthalen-1-yl]sulfonylamino]phenyl]propanamide (CAS 233255-39-5) is a chemical compound with the molecular formula C22H25N3O4S and a molecular weight of 427.5 g/mol. IUPAC name: 3-hydroxy-2,2-dimethyl-N-[4-[[5-(methylamino)naphthalen-1-yl]sulfonylamino]phenyl]propanamide. InChIKey: YUJQCLQKLOZLMR-UHFFFAOYSA-N.
| Molecular formula | C22H25N3O4S |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 3-hydroxy-2,2-dimethyl-N-[4-[[5-(methylamino)naphthalen-1-yl]sulfonylamino]phenyl]propanamide |
| InChIKey | YUJQCLQKLOZLMR-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(=O)NC1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC3=C2C=CC=C3NC |
Computed by PubChem (NCBI)