CAS 686770-80-9 appears in our catalog under these names: BC 11-38/ 98.72% (existing batch purity), BC 11–38, BC11-38 99%, 3-Phenyl-2-(propylthio)-6,7-dihydrothieno[3,2-d]pyrimidin-4(3H)-one, 97%, 97%, BC11-38, 99.42%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
3-phenyl-2-propylsulfanyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one (CAS 686770-80-9) is a chemical compound with the molecular formula C15H16N2OS2 and a molecular weight of 304.4 g/mol. IUPAC name: 3-phenyl-2-propylsulfanyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one. InChIKey: YHNDCCKFNWDQGW-UHFFFAOYSA-N.
| Molecular formula | C15H16N2OS2 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 3-phenyl-2-propylsulfanyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
| InChIKey | YHNDCCKFNWDQGW-UHFFFAOYSA-N |
| SMILES | CCCSC1=NC2=C(C(=O)N1C3=CC=CC=C3)SCC2 |
Computed by PubChem (NCBI)