CAS 1817698-21-7 appears in our catalog under these names: BDP5290, 98%, BDP5290/ 98%, BDP5290, BDP5290 98%, BDP5290, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
4-chloro-1-piperidin-4-yl-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyrazole-3-carboxamide (CAS 1817698-21-7) is a chemical compound with the molecular formula C17H18ClN7O and a molecular weight of 371.8 g/mol. IUPAC name: 4-chloro-1-piperidin-4-yl-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyrazole-3-carboxamide. InChIKey: BPVZKUXLOLRECL-UHFFFAOYSA-N.
| Molecular formula | C17H18ClN7O |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | 4-chloro-1-piperidin-4-yl-N-(5-pyridin-2-yl-1H-pyrazol-4-yl)pyrazole-3-carboxamide |
| InChIKey | BPVZKUXLOLRECL-UHFFFAOYSA-N |
| SMILES | C1CNCCC1N2C=C(C(=N2)C(=O)NC3=C(NN=C3)C4=CC=CC=N4)Cl |
Computed by PubChem (NCBI)