CAS 222638-67-7 appears in our catalog under these names: BEC (hydrochloride), BEC hydrochloride/ 99.28% (existing batch purity), BEC·HCl 97%, BEC, Hydrochloride 1PC X 5MG, BEC Hydrochloride, 97%, 97%. Offered by: GLPBio, TargetMol, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 100mg.
(2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid;hydrochloride (CAS 222638-67-7) is a chemical compound with the molecular formula C5H13BClNO4S and a molecular weight of 229.49 g/mol. IUPAC name: (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid;hydrochloride. InChIKey: GHPYJLCQYMAXGG-WCCKRBBISA-N.
| Molecular formula | C5H13BClNO4S |
|---|---|
| Molecular weight | 229.49 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid;hydrochloride |
| InChIKey | GHPYJLCQYMAXGG-WCCKRBBISA-N |
| SMILES | B(CCSC[C@@H](C(=O)O)N)(O)O.Cl |
Computed by PubChem (NCBI)