cas: 1314920-96-1 — see every product listed under this CAS number, including other names
BENZOFURAN-6-SULFONYL CHLORIDE, 97% (CAS 1314920-96-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332221-250MG |
| cas | 1314920-96-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 3902.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-benzofuran-6-sulfonyl chloride (CAS 1314920-96-1) is a chemical compound with the molecular formula C8H5ClO3S and a molecular weight of 216.64 g/mol. IUPAC name: 1-benzofuran-6-sulfonyl chloride. InChIKey: YPHJLHODUUQROD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3S |
|---|---|
| Molecular weight | 216.64 g/mol |
| IUPAC name | 1-benzofuran-6-sulfonyl chloride |
| InChIKey | YPHJLHODUUQROD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CO2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)