CAS 1314920-96-1 appears in our catalog under these names: 1-Benzofuran-6-sulfonyl chloride, Benzofuran-6-sulfonyl chloride, 95%, Benzofuran-6-sulfonyl chloride 97%, Benzofurane-6-sulfonyl chloride, 97%, 97%, BENZOFURAN-6-SULFONYL CHLORIDE, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
1-benzofuran-6-sulfonyl chloride (CAS 1314920-96-1) is a chemical compound with the molecular formula C8H5ClO3S and a molecular weight of 216.64 g/mol. IUPAC name: 1-benzofuran-6-sulfonyl chloride. InChIKey: YPHJLHODUUQROD-UHFFFAOYSA-N.
| Molecular formula | C8H5ClO3S |
|---|---|
| Molecular weight | 216.64 g/mol |
| IUPAC name | 1-benzofuran-6-sulfonyl chloride |
| InChIKey | YPHJLHODUUQROD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CO2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)