cas: 878-23-9 — see every product listed under this CAS number, including other names
BEP 98% (CAS 878-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164811-250mg |
| cas | 878-23-9 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 565.06 Pln | |
| Ambeed | 100g | 1744.31 Pln | |
| Ambeed | 500g | 6911.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164811 |
2-bromo-1-ethylpyridin-1-ium tetrafluoroborate (CAS 878-23-9) is a chemical compound with the molecular formula C7H9BBrF4N and a molecular weight of 273.86 g/mol. IUPAC name: 2-bromo-1-ethylpyridin-1-ium tetrafluoroborate. InChIKey: YJDXVQLBIAJTHP-UHFFFAOYSA-N.
| Molecular formula | C7H9BBrF4N |
|---|---|
| Molecular weight | 273.86 g/mol |
| IUPAC name | 2-bromo-1-ethylpyridin-1-ium tetrafluoroborate |
| InChIKey | YJDXVQLBIAJTHP-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC[N+]1=CC=CC=C1Br |
Computed by PubChem (NCBI)