CAS 878-23-9 appears in our catalog under these names: 2-Bromo-1-ethyl-pyridinium tetrafluoroborate, 97%, 2-Bromo-1-ethylpyridinium Tetrafluoroborate, >98.0%(HPLC)(T), BEP, BEP 98%, 2-BROMO-1-ETHYL-PYRIDINIUM TETRAFLUOROB&. Offered by: Thermo Scientific (Acros), TCI, Chemat, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 25g, 1g, 250mg, 10g, 100g, 500g.
2-bromo-1-ethylpyridin-1-ium tetrafluoroborate (CAS 878-23-9) is a chemical compound with the molecular formula C7H9BBrF4N and a molecular weight of 273.86 g/mol. IUPAC name: 2-bromo-1-ethylpyridin-1-ium tetrafluoroborate. InChIKey: YJDXVQLBIAJTHP-UHFFFAOYSA-N.
| Molecular formula | C7H9BBrF4N |
|---|---|
| Molecular weight | 273.86 g/mol |
| IUPAC name | 2-bromo-1-ethylpyridin-1-ium tetrafluoroborate |
| InChIKey | YJDXVQLBIAJTHP-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CC[N+]1=CC=CC=C1Br |
Computed by PubChem (NCBI)