CAS 2244452-09-1 appears in our catalog under these names: BI-4924/ 99.55% (existing batch purity), BI-4924, BI-4924, 99.55%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 2mg, 50 mg, 10 mg, 5 mg, 1 mg.
2-[4-[(1S)-1-[(4,5-dichloro-1,6-dimethylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]sulfonylacetic acid (CAS 2244452-09-1) is a chemical compound with the molecular formula C21H20Cl2N2O6S and a molecular weight of 499.4 g/mol. IUPAC name: 2-[4-[(1S)-1-[(4,5-dichloro-1,6-dimethylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]sulfonylacetic acid. InChIKey: CJEJFFCPVBZSIE-OAHLLOKOSA-N.
| Molecular formula | C21H20Cl2N2O6S |
|---|---|
| Molecular weight | 499.4 g/mol |
| IUPAC name | 2-[4-[(1S)-1-[(4,5-dichloro-1,6-dimethylindole-2-carbonyl)amino]-2-hydroxyethyl]phenyl]sulfonylacetic acid |
| InChIKey | CJEJFFCPVBZSIE-OAHLLOKOSA-N |
| SMILES | CC1=CC2=C(C=C(N2C)C(=O)N[C@H](CO)C3=CC=C(C=C3)S(=O)(=O)CC(=O)O)C(=C1Cl)Cl |
Computed by PubChem (NCBI)