CAS 1875036-75-1 appears in our catalog under these names: BI8626/ 99.84% (existing batch purity), BI8626, N-(3-(Aminomethyl)benzyl)-8-(4-benzylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-4-amine, 99.84% ,, 99.84% ,, BI8626, 98.49%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10 mg.
N-[[3-(aminomethyl)phenyl]methyl]-4-(4-benzylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-8-amine (CAS 1875036-75-1) is a chemical compound with the molecular formula C25H28N8 and a molecular weight of 440.5 g/mol. IUPAC name: N-[[3-(aminomethyl)phenyl]methyl]-4-(4-benzylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-8-amine. InChIKey: DZDNGSNKWIORRZ-UHFFFAOYSA-N.
| Molecular formula | C25H28N8 |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | N-[[3-(aminomethyl)phenyl]methyl]-4-(4-benzylpiperazin-1-yl)pyrimido[5,4-d]pyrimidin-8-amine |
| InChIKey | DZDNGSNKWIORRZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C3=NC=NC4=C3N=CN=C4NCC5=CC=CC(=C5)CN |
Computed by PubChem (NCBI)