cas: 1233855-46-3 — see every product listed under this CAS number, including other names
BIA 10-2474 99% (CAS 1233855-46-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100075-1mg |
| cas | 1233855-46-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 147.88 Pln | |
| Ambeed | 5mg | 220.19 Pln | |
| Ambeed | 10mg | 286.94 Pln | |
| Ambeed | 25mg | 420.44 Pln | |
| Ambeed | 50mg | 631.81 Pln | |
| Ambeed | 100mg | 954.44 Pln | |
| Ambeed | 250mg | 1571.88 Pln | |
| Ambeed | 1g | 4269.69 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A100075 |
N-cyclohexyl-N-methyl-4-(1-oxidopyridin-1-ium-3-yl)imidazole-1-carboxamide (CAS 1233855-46-3) is a chemical compound with the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. IUPAC name: N-cyclohexyl-N-methyl-4-(1-oxidopyridin-1-ium-3-yl)imidazole-1-carboxamide. InChIKey: DOWVMJFBDGWVML-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O2 |
|---|---|
| Molecular weight | 300.36 g/mol |
| IUPAC name | N-cyclohexyl-N-methyl-4-(1-oxidopyridin-1-ium-3-yl)imidazole-1-carboxamide |
| InChIKey | DOWVMJFBDGWVML-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCC1)C(=O)N2C=C(N=C2)C3=C[N+](=CC=C3)[O-] |
Computed by PubChem (NCBI)