CAS 1414568-27-6 is the registry number for tert-Butyl 3-amino-2-phenyl-4,6-dihydropyrrolo(3,4-c)pyrazole-5(2H)-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Tert-butyl 3-amino-2-phenyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylate (CAS 1414568-27-6) is a chemical compound with the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. IUPAC name: tert-butyl 3-amino-2-phenyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylate. InChIKey: WBRPPJOVZWJCMT-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O2 |
|---|---|
| Molecular weight | 300.36 g/mol |
| IUPAC name | tert-butyl 3-amino-2-phenyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5-carboxylate |
| InChIKey | WBRPPJOVZWJCMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(N(N=C2C1)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)