cas: 1113001-76-5 — see every product listed under this CAS number, including other names
BICYCLO[1.1.1]PENTANE-1-ACETIC ACID, 3-CARBOXY-, 1-(1,1-DIMETHYLETHYL) ESTER, 97% (CAS 1113001-76-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504364-100MG |
| cas | 1113001-76-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1528.65 Pln | |
| Fluorochem | 250mg | 2689.70 Pln | |
| Fluorochem | 500mg | 4267.27 Pln | |
| Fluorochem | 1g | 5318.98 Pln | |
| Fluorochem | 5g | 18491.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1113001-76-5) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: KRVGWJDDWNGIED-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | KRVGWJDDWNGIED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC12CC(C1)(C2)C(=O)O |
Computed by PubChem (NCBI)