CAS 1113001-76-5 appears in our catalog under these names: Bicyclo[1.1.1]pentane-1-acetic acid, 3-carboxy-, 1-(1,1-dimethylethyl) ester, 95%, 3-(2-(tert-Butoxy)-2-oxoethyl)bicyclo[1.1.1]pentane-1-carboxylic acid, 97%, 97%, BICYCLO[1.1.1]PENTANE-1-ACETIC ACID, 3-CARBOXY-, 1-(1,1-DIMETHYLETHYL) ESTER, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]bicyclo[1.1.1]pentane-1-carboxylic acid (CAS 1113001-76-5) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]bicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: KRVGWJDDWNGIED-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]bicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | KRVGWJDDWNGIED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC12CC(C1)(C2)C(=O)O |
Computed by PubChem (NCBI)