CAS 746667-48-1 appears in our catalog under these names: BIO-013077-01, 95+%, BIO–013077–01, BIO-013077-01/ 99.87% (existing batch purity), Bio-013077-01, 6-(3-(6-Methylpyridin-2-yl)-1H-pyrazol-4-yl)quinoxaline, 95+%, 95+%. Offered by: AmBeed, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 1g, 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 250mg.
6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoxaline (CAS 746667-48-1) is a chemical compound with the molecular formula C17H13N5 and a molecular weight of 287.32 g/mol. IUPAC name: 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoxaline. InChIKey: VXJLYXCHOKEODY-UHFFFAOYSA-N.
| Molecular formula | C17H13N5 |
|---|---|
| Molecular weight | 287.32 g/mol |
| IUPAC name | 6-[5-(6-methyl-2-pyridinyl)-1H-pyrazol-4-yl]quinoxaline |
| InChIKey | VXJLYXCHOKEODY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=C(C=NN2)C3=CC4=NC=CN=C4C=C3 |
Computed by PubChem (NCBI)