CAS 917909-71-8 appears in our catalog under these names: BIT225/ 98.8% (existing batch purity), BIT225, BIT225 98%, N-(Aminoiminomethyl)-5-(1-methyl-1H-pyrazol-4-yl)-2-naphthalenecarboxamide, BIT-225, 98.87%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 200mg.
N-(diaminomethylidene)-5-(1-methylpyrazol-4-yl)naphthalene-2-carboxamide (CAS 917909-71-8) is a chemical compound with the molecular formula C16H15N5O and a molecular weight of 293.32 g/mol. IUPAC name: N-(diaminomethylidene)-5-(1-methylpyrazol-4-yl)naphthalene-2-carboxamide. InChIKey: WVROWPPEIMRGAB-UHFFFAOYSA-N.
| Molecular formula | C16H15N5O |
|---|---|
| Molecular weight | 293.32 g/mol |
| IUPAC name | N-(diaminomethylidene)-5-(1-methylpyrazol-4-yl)naphthalene-2-carboxamide |
| InChIKey | WVROWPPEIMRGAB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC=CC3=C2C=CC(=C3)C(=O)N=C(N)N |
Computed by PubChem (NCBI)