CAS 1538604-68-0 appears in our catalog under these names: BLU9931/ 99.85% (existing batch purity), BLU9931, BLU9931, 95%, BLU9931 99%, BLU9931, 99%, 99%. Offered by: TargetMol, GLPBio, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 1mg.
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylphenyl]prop-2-enamide (CAS 1538604-68-0) is a chemical compound with the molecular formula C26H22Cl2N4O3 and a molecular weight of 509.4 g/mol. IUPAC name: N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylphenyl]prop-2-enamide. InChIKey: TXEBNKKOLVBTFK-UHFFFAOYSA-N.
| Molecular formula | C26H22Cl2N4O3 |
|---|---|
| Molecular weight | 509.4 g/mol |
| IUPAC name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
| InChIKey | TXEBNKKOLVBTFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C=C)NC2=NC=C3C=C(C=CC3=N2)C4=C(C(=CC(=C4Cl)OC)OC)Cl |
Computed by PubChem (NCBI)