CAS 516480-79-8 appears in our catalog under these names: BML-277/ 99.09% (existing batch purity), BML–277, BML-277 98%, CHK2 INHIBITOR II HYDRATE, Chk2 Inhibitor II 1PC X 1MG. Offered by: TargetMol, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 1mg.
2-[4-(4-chlorophenoxy)phenyl]-3H-benzimidazole-5-carboxamide (CAS 516480-79-8) is a chemical compound with the molecular formula C20H14ClN3O2 and a molecular weight of 363.8 g/mol. IUPAC name: 2-[4-(4-chlorophenoxy)phenyl]-3H-benzimidazole-5-carboxamide. InChIKey: UXGJAOIJSROTTN-UHFFFAOYSA-N.
| Molecular formula | C20H14ClN3O2 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | 2-[4-(4-chlorophenoxy)phenyl]-3H-benzimidazole-5-carboxamide |
| InChIKey | UXGJAOIJSROTTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)C(=O)N)OC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)