cas: 1215703-04-0 — see every product listed under this CAS number, including other names
BMS 182874 hydrochloride (CAS 1215703-04-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol, GLPBio.
| brand | TargetMol |
|---|---|
| catalog number | T21790-1mg |
| cas | 1215703-04-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 665.09 Pln | |
| TargetMol | 2mg | 817.70 Pln | |
| TargetMol | 5mg | 1149.74 Pln | |
| TargetMol | 10mg | 1627.69 Pln | |
| TargetMol | 25mg | 2597.55 Pln | |
| TargetMol | 50mg | 3547.29 Pln | |
| TargetMol | 100mg | 4855.35 Pln | |
| TargetMol | 200mg | 6482.04 Pln | |
| GLPBio | 10mg | 1799.93 Pln | |
| GLPBio | 50mg | 6251.08 Pln |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
5-(dimethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)naphthalene-1-sulfonamide;hydrochloride (CAS 1215703-04-0) is a chemical compound with the molecular formula C17H20ClN3O3S and a molecular weight of 381.9 g/mol. IUPAC name: 5-(dimethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)naphthalene-1-sulfonamide;hydrochloride. InChIKey: UZZFRNZGYDOBAO-UHFFFAOYSA-N.
| Molecular formula | C17H20ClN3O3S |
|---|---|
| Molecular weight | 381.9 g/mol |
| IUPAC name | 5-(dimethylamino)-N-(3,4-dimethyl-1,2-oxazol-5-yl)naphthalene-1-sulfonamide;hydrochloride |
| InChIKey | UZZFRNZGYDOBAO-UHFFFAOYSA-N |
| SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=CC3=C2C=CC=C3N(C)C.Cl |
Computed by PubChem (NCBI)