CAS 202822-23-9 appears in our catalog under these names: BMS-195270/ 98.7% (existing batch purity), BMS–195270, BMS-195270 99%, BMS-195270, BMS-195270, 97.52%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
2-(5-chloro-2-hydroxyphenyl)-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one (CAS 202822-23-9) is a chemical compound with the molecular formula C15H9ClF3N3O2 and a molecular weight of 355.70 g/mol. IUPAC name: 2-(5-chloro-2-hydroxyphenyl)-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one. InChIKey: PHWHYZMFGGOJEU-UHFFFAOYSA-N.
| Molecular formula | C15H9ClF3N3O2 |
|---|---|
| Molecular weight | 355.70 g/mol |
| IUPAC name | 2-(5-chloro-2-hydroxyphenyl)-5-[2-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| InChIKey | PHWHYZMFGGOJEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN(C(=O)N2)C3=C(C=CC(=C3)Cl)O)C(F)(F)F |
Computed by PubChem (NCBI)