CAS 300657-03-8 appears in our catalog under these names: BMS-309403/ 99.54% (existing batch purity), BMS 309403, BMS-309403, FABP4 Inhibitor, BMS-309403 98%. Offered by: TargetMol, GLPBio, Chemat, Biosynth, Ambeed. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetic acid (CAS 300657-03-8) is a chemical compound with the molecular formula C31H26N2O3 and a molecular weight of 474.5 g/mol. IUPAC name: 2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetic acid. InChIKey: SJRVJRYZAQYCEE-UHFFFAOYSA-N.
| Molecular formula | C31H26N2O3 |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | 2-[3-[2-(5-ethyl-3,4-diphenylpyrazol-1-yl)phenyl]phenoxy]acetic acid |
| InChIKey | SJRVJRYZAQYCEE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=NN1C2=CC=CC=C2C3=CC(=CC=C3)OCC(=O)O)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)