CAS 729607-74-3 appears in our catalog under these names: BMS–707035, BMS-707035/ 99.83% (existing batch purity), BMS-707035, 98%, 98%, BMS-707035, 99.99%, BMS-707035 (Standard). Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 2mg, 25mg, 100 mg.
2-(1,1-dioxothiazinan-2-yl)-N-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxamide (CAS 729607-74-3) is a chemical compound with the molecular formula C17H19FN4O5S and a molecular weight of 410.4 g/mol. IUPAC name: 2-(1,1-dioxothiazinan-2-yl)-N-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxamide. InChIKey: VNIWZCGZPBJWBI-UHFFFAOYSA-N.
| Molecular formula | C17H19FN4O5S |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | 2-(1,1-dioxothiazinan-2-yl)-N-[(4-fluorophenyl)methyl]-5-hydroxy-1-methyl-6-oxopyrimidine-4-carboxamide |
| InChIKey | VNIWZCGZPBJWBI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(N=C1N2CCCCS2(=O)=O)C(=O)NCC3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)