CAS 1675201-90-7 appears in our catalog under these names: BMS-8/ 99.06% (existing batch purity), BMS–8, BMS-8, BMS-8 98%, BMS 8, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1-[[3-bromo-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid (CAS 1675201-90-7) is a chemical compound with the molecular formula C27H28BrNO3 and a molecular weight of 494.4 g/mol. IUPAC name: 1-[[3-bromo-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid. InChIKey: QRXBPPWUGITQLE-UHFFFAOYSA-N.
| Molecular formula | C27H28BrNO3 |
|---|---|
| Molecular weight | 494.4 g/mol |
| IUPAC name | 1-[[3-bromo-4-[(2-methyl-3-phenylphenyl)methoxy]phenyl]methyl]piperidine-2-carboxylic acid |
| InChIKey | QRXBPPWUGITQLE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC=CC=C2)COC3=C(C=C(C=C3)CN4CCCCC4C(=O)O)Br |
Computed by PubChem (NCBI)