CAS 2055200-88-7 appears in our catalog under these names: BMS-986224/ 98.82% (existing batch purity), BMS–986224, BMS-986224, 99.67% ,, 99.67% ,, BMS-986224, 99.44%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 100 mg, 1 mg, 50 mg, 5 mg.
3-[5-[(5-chloro-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(2,6-dimethoxyphenyl)-6-(ethoxymethyl)-4-hydroxy-1H-pyridin-2-one (CAS 2055200-88-7) is a chemical compound with the molecular formula C24H23ClN4O6 and a molecular weight of 498.9 g/mol. IUPAC name: 3-[5-[(5-chloro-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(2,6-dimethoxyphenyl)-6-(ethoxymethyl)-4-hydroxy-1H-pyridin-2-one. InChIKey: AGZKELPIAJYRDT-UHFFFAOYSA-N.
| Molecular formula | C24H23ClN4O6 |
|---|---|
| Molecular weight | 498.9 g/mol |
| IUPAC name | 3-[5-[(5-chloro-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(2,6-dimethoxyphenyl)-6-(ethoxymethyl)-4-hydroxy-1H-pyridin-2-one |
| InChIKey | AGZKELPIAJYRDT-UHFFFAOYSA-N |
| SMILES | CCOCC1=C(C(=C(C(=O)N1)C2=NN=C(O2)CC3=NC=C(C=C3)Cl)O)C4=C(C=CC=C4OC)OC |
Computed by PubChem (NCBI)