CAS 1923844-48-7 appears in our catalog under these names: BMS–986242, BMS-986242/ 98.25% (existing batch purity), BMS-986242, BMS-986242 98%, BMS-986242, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 100 mg, 25 mg.
4-chloro-N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]benzamide (CAS 1923844-48-7) is a chemical compound with the molecular formula C24H24ClFN2O and a molecular weight of 410.9 g/mol. IUPAC name: 4-chloro-N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]benzamide. InChIKey: AOJCHFNHRLPISK-KLAILNCOSA-N.
| Molecular formula | C24H24ClFN2O |
|---|---|
| Molecular weight | 410.9 g/mol |
| IUPAC name | 4-chloro-N-[(1R)-1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]ethyl]benzamide |
| InChIKey | AOJCHFNHRLPISK-KLAILNCOSA-N |
| SMILES | C[C@H](C1CCC(CC1)C2=C3C=C(C=CC3=NC=C2)F)NC(=O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)