CAS 1776115-10-6 appears in our catalog under these names: BMS 986188, BMS986188/ 98.76% (existing batch purity), BMS 986188, ≥98%, ≥98%, BMS-986188, 99.06%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 25mg, 50mg, 100mg, 200mg.
9-[4-[(2-bromophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (CAS 1776115-10-6) is a chemical compound with the molecular formula C30H31BrO4 and a molecular weight of 535.5 g/mol. IUPAC name: 9-[4-[(2-bromophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione. InChIKey: BBCHHZHONQIODT-UHFFFAOYSA-N.
| Molecular formula | C30H31BrO4 |
|---|---|
| Molecular weight | 535.5 g/mol |
| IUPAC name | 9-[4-[(2-bromophenyl)methoxy]phenyl]-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| InChIKey | BBCHHZHONQIODT-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(C3=C(O2)CC(CC3=O)(C)C)C4=CC=C(C=C4)OCC5=CC=CC=C5Br)C(=O)C1)C |
Computed by PubChem (NCBI)