CAS 123259-91-6 appears in our catalog under these names: BMY-21502/ 99.54% (existing batch purity), BMY 21502, BMY-21502, 98.98%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
1-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one (CAS 123259-91-6) is a chemical compound with the molecular formula C15H19F3N4O and a molecular weight of 328.33 g/mol. IUPAC name: 1-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one. InChIKey: KEWFMWJJMGQBAN-UHFFFAOYSA-N.
| Molecular formula | C15H19F3N4O |
|---|---|
| Molecular weight | 328.33 g/mol |
| IUPAC name | 1-[[1-[2-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]methyl]pyrrolidin-2-one |
| InChIKey | KEWFMWJJMGQBAN-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)CC2CCN(CC2)C3=NC(=NC=C3)C(F)(F)F |
Computed by PubChem (NCBI)