CAS 121207-31-6 appears in our catalog under these names: BDP 493/503 lipid stain, 95%, Pyrromethene 546, 95%, Pyrromethene 546, >95% (HPLC), BODIPY 493/503/ 99.62% (existing batch purity), BODIPY 493/503. Offered by: Lumiprobe, Combi-blocks, TRC, TargetMol, GLPBio. Available pack sizes: 25mg, 1g, 100mg, 10mg, 500mg, 50mg, 200mg, 5mg.
2,2-difluoro-4,6,8,10,12-pentamethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (CAS 121207-31-6) is a chemical compound with the molecular formula C14H17BF2N2 and a molecular weight of 262.11 g/mol. IUPAC name: 2,2-difluoro-4,6,8,10,12-pentamethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene. InChIKey: DRJHPEGNOPSARR-UHFFFAOYSA-N.
| Molecular formula | C14H17BF2N2 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 2,2-difluoro-4,6,8,10,12-pentamethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| InChIKey | DRJHPEGNOPSARR-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC(=C2C(=C3[N+]1=C(C=C3C)C)C)C)C)(F)F |
Computed by PubChem (NCBI)