CAS 21658-70-8 appears in our catalog under these names: BDP 505/515 lipid stain, 95%, BODIPY 505/515/ 99.7% (existing batch purity), BODIPY 505/515, BODIPY 505/515 98%, DIFLUORO{2-[(3,5-DIMETHYL-2H-PYRROL-2-Y&. Offered by: Lumiprobe, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g, 250 mg.
2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (CAS 21658-70-8) is a chemical compound with the molecular formula C13H15BF2N2 and a molecular weight of 248.08 g/mol. IUPAC name: 2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene. InChIKey: TWYZTUZOEQTCOO-UHFFFAOYSA-N.
| Molecular formula | C13H15BF2N2 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| InChIKey | TWYZTUZOEQTCOO-UHFFFAOYSA-N |
| SMILES | [B-]1(N2C(=CC(=C2C=C3[N+]1=C(C=C3C)C)C)C)(F)F |
Computed by PubChem (NCBI)