CAS 2387633-15-8 appears in our catalog under these names: BOS-318, 98%, BOS-318/ 98.6% (existing batch purity), BOS–318, BOS-318 98%, BOS-318. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
2-[1-[[2-(3,5-dichlorophenyl)-6-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]oxy-4-pyridinyl]methyl]piperidin-4-yl]acetic acid (CAS 2387633-15-8) is a chemical compound with the molecular formula C28H32Cl2N6O3 and a molecular weight of 571.5 g/mol. IUPAC name: 2-[1-[[2-(3,5-dichlorophenyl)-6-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]oxy-4-pyridinyl]methyl]piperidin-4-yl]acetic acid. InChIKey: AZEJIKZNBHEXCM-UHFFFAOYSA-N.
| Molecular formula | C28H32Cl2N6O3 |
|---|---|
| Molecular weight | 571.5 g/mol |
| IUPAC name | 2-[1-[[2-(3,5-dichlorophenyl)-6-[2-(4-methylpiperazin-1-yl)pyrimidin-5-yl]oxy-4-pyridinyl]methyl]piperidin-4-yl]acetic acid |
| InChIKey | AZEJIKZNBHEXCM-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=NC=C(C=N2)OC3=CC(=CC(=N3)C4=CC(=CC(=C4)Cl)Cl)CN5CCC(CC5)CC(=O)O |
Computed by PubChem (NCBI)