CAS 312281-74-6 appears in our catalog under these names: BPDBA/ 99.24% (existing batch purity), BPDBA, N-(1-Benzylpiperidin-4-yl)-2,4-dichlorobenzamide, 95%, 95%, BPDBA, 99.40%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg, 10 mg.
N-(1-benzylpiperidin-4-yl)-2,4-dichlorobenzamide (CAS 312281-74-6) is a chemical compound with the molecular formula C19H20Cl2N2O and a molecular weight of 363.3 g/mol. IUPAC name: N-(1-benzylpiperidin-4-yl)-2,4-dichlorobenzamide. InChIKey: OIDACLQVAGIDMT-UHFFFAOYSA-N.
| Molecular formula | C19H20Cl2N2O |
|---|---|
| Molecular weight | 363.3 g/mol |
| IUPAC name | N-(1-benzylpiperidin-4-yl)-2,4-dichlorobenzamide |
| InChIKey | OIDACLQVAGIDMT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=O)C2=C(C=C(C=C2)Cl)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)