cas: 314045-39-1 — see every product listed under this CAS number, including other names
BPTES 98% (CAS 314045-39-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A413914-1mg |
| cas | 314045-39-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 170.12 Pln | |
| Ambeed | 5mg | 275.81 Pln | |
| Ambeed | 10mg | 364.81 Pln | |
| Ambeed | 25mg | 565.06 Pln | |
| Ambeed | 50mg | 854.31 Pln | |
| Ambeed | 100mg | 1277.06 Pln | |
| Ambeed | 250mg | 2200.44 Pln | |
| Ambeed | 1g | 5715.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A413914 |
2-phenyl-N-[5-[2-[2-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide (CAS 314045-39-1) is a chemical compound with the molecular formula C24H24N6O2S3 and a molecular weight of 524.7 g/mol. IUPAC name: 2-phenyl-N-[5-[2-[2-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide. InChIKey: MDJIPXYRSZHCFS-UHFFFAOYSA-N.
| Molecular formula | C24H24N6O2S3 |
|---|---|
| Molecular weight | 524.7 g/mol |
| IUPAC name | 2-phenyl-N-[5-[2-[2-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| InChIKey | MDJIPXYRSZHCFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=NN=C(S2)CCSCCC3=NN=C(S3)NC(=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)