CAS 314045-39-1 appears in our catalog under these names: BPTES, BPTES/ 98.06% (existing batch purity), Glutaminase Inhibitor II, BPTES, BPTES 98%, BPTES, 98%, 98%. Offered by: GLPBio, TRC, TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 250mg, 10mg, 10mM (in 1ml dmso), 2mg, 5mg, 25mg, 50mg.
2-phenyl-N-[5-[2-[2-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide (CAS 314045-39-1) is a chemical compound with the molecular formula C24H24N6O2S3 and a molecular weight of 524.7 g/mol. IUPAC name: 2-phenyl-N-[5-[2-[2-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide. InChIKey: MDJIPXYRSZHCFS-UHFFFAOYSA-N.
| Molecular formula | C24H24N6O2S3 |
|---|---|
| Molecular weight | 524.7 g/mol |
| IUPAC name | 2-phenyl-N-[5-[2-[2-[5-[(2-phenylacetyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]acetamide |
| InChIKey | MDJIPXYRSZHCFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=NN=C(S2)CCSCCC3=NN=C(S3)NC(=O)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)