Products 909664-41-1
CAS 909664-41-1 appears in our catalog under these names: BPU-11/ 98.37% (existing batch purity), BPU–11, BPU-11, BPU-11, 98.08%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 10mM (in 1ml dmso), 5 mg, 50 mg, 25 mg.
1-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-(2-phenylphenyl)-1-(pyridin-3-ylmethyl)urea (CAS 909664-41-1) is a chemical compound with the molecular formula C32H31N5O and a molecular weight of 501.6 g/mol. IUPAC name: 1-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-(2-phenylphenyl)-1-(pyridin-3-ylmethyl)urea. InChIKey: UIIRFZUAAAFHFB-UHFFFAOYSA-N.
| Molecular formula | C32H31N5O |
|---|---|
| Molecular weight | 501.6 g/mol |
| IUPAC name | 1-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-(2-phenylphenyl)-1-(pyridin-3-ylmethyl)urea |
| InChIKey | UIIRFZUAAAFHFB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N(CC2=CN=CC=C2)C(=O)NC3=CC=CC=C3C4=CC=CC=C4)CC5=CC(=CC=C5)C#N |
Computed by PubChem (NCBI)