CAS 2760881-74-9 appears in our catalog under these names: BRD0639/ 99.46% (existing batch purity), BRD0639, BRD0639, 98.04%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
(2S)-2-(4-chloro-6-oxopyridazin-1-yl)-N-[4-methyl-3-(2-pyridin-2-ylethylsulfamoyl)phenyl]propanamide (CAS 2760881-74-9) is a chemical compound with the molecular formula C21H22ClN5O4S and a molecular weight of 475.9 g/mol. IUPAC name: (2S)-2-(4-chloro-6-oxopyridazin-1-yl)-N-[4-methyl-3-(2-pyridin-2-ylethylsulfamoyl)phenyl]propanamide. InChIKey: BXDCFRRDENJUJM-HNNXBMFYSA-N.
| Molecular formula | C21H22ClN5O4S |
|---|---|
| Molecular weight | 475.9 g/mol |
| IUPAC name | (2S)-2-(4-chloro-6-oxopyridazin-1-yl)-N-[4-methyl-3-(2-pyridin-2-ylethylsulfamoyl)phenyl]propanamide |
| InChIKey | BXDCFRRDENJUJM-HNNXBMFYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)[C@H](C)N2C(=O)C=C(C=N2)Cl)S(=O)(=O)NCCC3=CC=CC=N3 |
Computed by PubChem (NCBI)