Products 503105-88-2
CAS 503105-88-2 appears in our catalog under these names: BRITE–338733, BRITE-338733/ 98.82% (existing batch purity), BRITE-338733, BRITE-338733, ≥99%, ≥99%, BRITE-338733, 98.93%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 2mg, 200mg.
2-[4-(5-ethylfuran-2-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-pyridinyl]-4-methylphenol (CAS 503105-88-2) is a chemical compound with the molecular formula C27H35N3O2 and a molecular weight of 433.6 g/mol. IUPAC name: 2-[4-(5-ethylfuran-2-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-pyridinyl]-4-methylphenol. InChIKey: PKYYVDCUXJXUPN-UHFFFAOYSA-N.
| Molecular formula | C27H35N3O2 |
|---|---|
| Molecular weight | 433.6 g/mol |
| IUPAC name | 2-[4-(5-ethylfuran-2-yl)-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-2-pyridinyl]-4-methylphenol |
| InChIKey | PKYYVDCUXJXUPN-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(O1)C2=CC(=NC(=C2)NC3CC(NC(C3)(C)C)(C)C)C4=C(C=CC(=C4)C)O |
Computed by PubChem (NCBI)
Synonyms:
orb1219276, orb1306031