cas: 564476-32-0 — see every product listed under this CAS number, including other names
BROMO-PEG5-T-BUTYL ESTER, 97% (CAS 564476-32-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F533534-100MG |
| cas | 564476-32-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1856.66 Pln | |
| Fluorochem | 25g | 6058.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 564476-32-0) is a chemical compound with the molecular formula C15H29BrO6 and a molecular weight of 385.29 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: WLKHUFASPMJBHB-UHFFFAOYSA-N.
| Molecular formula | C15H29BrO6 |
|---|---|
| Molecular weight | 385.29 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | WLKHUFASPMJBHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCBr |
Computed by PubChem (NCBI)