CAS 564476-32-0 appears in our catalog under these names: Bromo-peg4-t-butyl ester, 98%, Br–PEG4–C2–Boc, Br-PEG4-C2-Boc 98%, 1,1-Dimethylethyl 15-bromo-4,7,10,13-tetraoxapentadecanoate, 98%, 98%, Br-PEG4-C2-Boc, 99.96%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 50mg, 25g, 500mg.
Tert-butyl 3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propanoate (CAS 564476-32-0) is a chemical compound with the molecular formula C15H29BrO6 and a molecular weight of 385.29 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: WLKHUFASPMJBHB-UHFFFAOYSA-N.
| Molecular formula | C15H29BrO6 |
|---|---|
| Molecular weight | 385.29 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2-bromoethoxy)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | WLKHUFASPMJBHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCBr |
Computed by PubChem (NCBI)