CAS 1397219-81-6 appears in our catalog under these names: BS-181 hydrochloride/ 99.97% (existing batch purity), BS–181 HCl, BS 181 hydrochloride, N5-(6-Aminohexyl)-N7-benzyl-3-isopropylpyrazolo[1,5-a]pyrimidine-5,7-diamine hydrochloride, 98%, 98%, BS-181 (hydrochloride), 99.93%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-N-(6-aminohexyl)-7-N-benzyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine;hydrochloride (CAS 1397219-81-6) is a chemical compound with the molecular formula C22H33ClN6 and a molecular weight of 417.0 g/mol. IUPAC name: 5-N-(6-aminohexyl)-7-N-benzyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine;hydrochloride. InChIKey: NVIJWMOQODWNFN-UHFFFAOYSA-N.
| Molecular formula | C22H33ClN6 |
|---|---|
| Molecular weight | 417.0 g/mol |
| IUPAC name | 5-N-(6-aminohexyl)-7-N-benzyl-3-propan-2-ylpyrazolo[1,5-a]pyrimidine-5,7-diamine;hydrochloride |
| InChIKey | NVIJWMOQODWNFN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2N=C(C=C(N2N=C1)NCC3=CC=CC=C3)NCCCCCCN.Cl |
Computed by PubChem (NCBI)