CAS 924537-98-4 appears in our catalog under these names: BT-13/ 98.41% (existing batch purity), BT 13, BT-13. Offered by: TargetMol, Biosynth, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
N,N-diethyl-3-[4-[4-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-4-methoxybenzenesulfonamide (CAS 924537-98-4) is a chemical compound with the molecular formula C23H27F4N3O4S and a molecular weight of 517.5 g/mol. IUPAC name: N,N-diethyl-3-[4-[4-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-4-methoxybenzenesulfonamide. InChIKey: GTDJOGZANHPKMR-UHFFFAOYSA-N.
| Molecular formula | C23H27F4N3O4S |
|---|---|
| Molecular weight | 517.5 g/mol |
| IUPAC name | N,N-diethyl-3-[4-[4-fluoro-2-(trifluoromethyl)benzoyl]piperazin-1-yl]-4-methoxybenzenesulfonamide |
| InChIKey | GTDJOGZANHPKMR-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)OC)N2CCN(CC2)C(=O)C3=C(C=C(C=C3)F)C(F)(F)F |
Computed by PubChem (NCBI)