CAS 688309-70-8 appears in our catalog under these names: BX430/ 99.95% (existing batch purity), BX 430, BX 430, BX430 98%, 1-(2,6-Dibromo-4-isopropylphenyl)-3-(pyridin-3-yl)urea, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
1-(2,6-dibromo-4-propan-2-ylphenyl)-3-pyridin-3-ylurea (CAS 688309-70-8) is a chemical compound with the molecular formula C15H15Br2N3O and a molecular weight of 413.11 g/mol. IUPAC name: 1-(2,6-dibromo-4-propan-2-ylphenyl)-3-pyridin-3-ylurea. InChIKey: JFNKIJKRXKPQCC-UHFFFAOYSA-N.
| Molecular formula | C15H15Br2N3O |
|---|---|
| Molecular weight | 413.11 g/mol |
| IUPAC name | 1-(2,6-dibromo-4-propan-2-ylphenyl)-3-pyridin-3-ylurea |
| InChIKey | JFNKIJKRXKPQCC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)Br)NC(=O)NC2=CN=CC=C2)Br |
Computed by PubChem (NCBI)