CAS 195533-53-0 appears in our catalog under these names: Batabulin, 98%, Batabulin/ 98.35% (existing batch purity), Batabulin, Batabulin 98%, 2,3,4,5,6-Pentafluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide, 98%, 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide (CAS 195533-53-0) is a chemical compound with the molecular formula C13H7F6NO3S and a molecular weight of 371.26 g/mol. IUPAC name: 2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide. InChIKey: ROZCIVXTLACYNY-UHFFFAOYSA-N.
| Molecular formula | C13H7F6NO3S |
|---|---|
| Molecular weight | 371.26 g/mol |
| IUPAC name | 2,3,4,5,6-pentafluoro-N-(3-fluoro-4-methoxyphenyl)benzenesulfonamide |
| InChIKey | ROZCIVXTLACYNY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NS(=O)(=O)C2=C(C(=C(C(=C2F)F)F)F)F)F |
Computed by PubChem (NCBI)