CAS 22181-94-8 appears in our catalog under these names: Benin/ 99.58% (existing batch purity), Butocin, Butocin 98%, Benin, Benin, 99.15%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 5 mg.
Ethyl 2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetate (CAS 22181-94-8) is a chemical compound with the molecular formula C14H19N5O3S and a molecular weight of 337.40 g/mol. IUPAC name: ethyl 2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetate. InChIKey: GOZRRIWDZQPGMN-UHFFFAOYSA-N.
| Molecular formula | C14H19N5O3S |
|---|---|
| Molecular weight | 337.40 g/mol |
| IUPAC name | ethyl 2-[5-(7H-purin-6-ylsulfanyl)pentanoylamino]acetate |
| InChIKey | GOZRRIWDZQPGMN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC(=O)CCCCSC1=NC=NC2=C1NC=N2 |
Computed by PubChem (NCBI)