cas: 19428-14-9 — see every product listed under this CAS number, including other names
Benproperin phosphate, 98%, 98% (CAS 19428-14-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I42W-1g |
| cas | 19428-14-9 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 146.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid (CAS 19428-14-9) is a chemical compound with the molecular formula C21H30NO5P and a molecular weight of 407.4 g/mol. IUPAC name: 1-[1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid. InChIKey: MCVUURBOSHQXMK-UHFFFAOYSA-N.
| Molecular formula | C21H30NO5P |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | 1-[1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid |
| InChIKey | MCVUURBOSHQXMK-UHFFFAOYSA-N |
| SMILES | CC(COC1=CC=CC=C1CC2=CC=CC=C2)N3CCCCC3.OP(=O)(O)O |
Computed by PubChem (NCBI)