cas: 19428-14-9 — see every product listed under this CAS number, including other names
Benproperine (phosphate), 99.93% (CAS 19428-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-114657A-100 mg |
| cas | 19428-14-9 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 384.71 Pln | |
| MedChemExpress | 10mM/1mL | 412.57 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.93% |
1-[1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid (CAS 19428-14-9) is a chemical compound with the molecular formula C21H30NO5P and a molecular weight of 407.4 g/mol. IUPAC name: 1-[1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid. InChIKey: MCVUURBOSHQXMK-UHFFFAOYSA-N.
| Molecular formula | C21H30NO5P |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | 1-[1-(2-benzylphenoxy)propan-2-yl]piperidine;phosphoric acid |
| InChIKey | MCVUURBOSHQXMK-UHFFFAOYSA-N |
| SMILES | CC(COC1=CC=CC=C1CC2=CC=CC=C2)N3CCCCC3.OP(=O)(O)O |
Computed by PubChem (NCBI)