cas: 117490-57-0 — see every product listed under this CAS number, including other names
Benzaldehyde, 2-chloro-4-(phenylmethoxy)- (CAS 117490-57-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F246500-1G |
| cas | 117490-57-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2517.88 Pln | |
| Fluorochem | 5g | 7422.40 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloro-4-phenylmethoxybenzaldehyde (CAS 117490-57-0) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: 2-chloro-4-phenylmethoxybenzaldehyde. InChIKey: NYDXXBPGGPYUDR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 2-chloro-4-phenylmethoxybenzaldehyde |
| InChIKey | NYDXXBPGGPYUDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)