CAS 54118-74-0 is the registry number for (2-Chlorophenyl)(4-methoxyphenyl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
(2-chlorophenyl)-(4-methoxyphenyl)methanone (CAS 54118-74-0) is a chemical compound with the molecular formula C14H11ClO2 and a molecular weight of 246.69 g/mol. IUPAC name: (2-chlorophenyl)-(4-methoxyphenyl)methanone. InChIKey: JLAGTIGTDCDSNA-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO2 |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | (2-chlorophenyl)-(4-methoxyphenyl)methanone |
| InChIKey | JLAGTIGTDCDSNA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)